EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:86262 - D-kynurenine
| Formula | C10H12N2O3 |
| Net Charge | 0 |
| Average Mass | 208.217 |
| Monoisotopic Mass | 208.08479 |
| SMILES | Nc1ccccc1C(=O)C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/t8-/m1/s1 |
| InChIKey | YGPSJZOEDVAXAB-MRVPVSSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25030849) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (26041992) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-kynurenine (CHEBI:86262) has role human metabolite (CHEBI:77746) |
| D-kynurenine (CHEBI:86262) is a D-α-amino acid (CHEBI:16733) |
| D-kynurenine (CHEBI:86262) is a kynurenine (CHEBI:28683) |
| D-kynurenine (CHEBI:86262) is enantiomer of L-kynurenine (CHEBI:16946) |
| Incoming Relation(s) |
| L-kynurenine (CHEBI:16946) is enantiomer of D-kynurenine (CHEBI:86262) |
| D-kynurenine zwitterion (CHEBI:747001) is tautomer of D-kynurenine (CHEBI:86262) |
| IUPAC Name |
|---|
| (2R)-2-amino-4-(2-aminophenyl)-4-oxobutanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3206278 | Reaxys |
| CAS:13441-51-5 | ChemIDplus |
| Citations |
|---|