EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11N2O3 |
| Net Charge | -1 |
| Average Mass | 207.209 |
| Monoisotopic Mass | 207.07752 |
| SMILES | Nc1ccccc1C(=O)CC(N)C(=O)[O-] |
| InChI | InChI=1S/C10H12N2O3/c11-7-4-2-1-3-6(7)9(13)5-8(12)10(14)15/h1-4,8H,5,11-12H2,(H,14,15)/p-1 |
| InChIKey | YGPSJZOEDVAXAB-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kynureninate (CHEBI:67008) is a α-amino-acid anion (CHEBI:33558) |
| kynureninate (CHEBI:67008) is conjugate base of kynurenine (CHEBI:28683) |
| Incoming Relation(s) |
| L-kynureninate (CHEBI:67010) is a kynureninate (CHEBI:67008) |
| kynurenine (CHEBI:28683) is conjugate acid of kynureninate (CHEBI:67008) |
| IUPAC Name |
|---|
| 2-amino-4-(2-aminophenyl)-4-oxobutanoate |