EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H17O12 |
| Net Charge | -1 |
| Average Mass | 461.355 |
| Monoisotopic Mass | 461.07255 |
| SMILES | O=C([O-])[C@H]1O[C@@H](Oc2cc3oc(-c4ccc(O)cc4)cc(=O)c3c(O)c2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H18O12/c22-8-3-1-7(2-4-8)10-5-9(23)13-11(31-10)6-12(14(24)15(13)25)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-22,24-28H,(H,29,30)/p-1/t16-,17-,18+,19-,21+/m0/s1 |
| InChIKey | DJSISFGPUUYILV-ZFORQUDYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scutellarin(1−) (CHEBI:61284) is a carbohydrate acid derivative anion (CHEBI:63551) |
| scutellarin(1−) (CHEBI:61284) is a monocarboxylic acid anion (CHEBI:35757) |
| scutellarin(1−) (CHEBI:61284) is conjugate base of scutellarin (CHEBI:61278) |
| Incoming Relation(s) |
| scutellarin (CHEBI:61278) is conjugate acid of scutellarin(1−) (CHEBI:61284) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranosiduronate |
| Synonym | Source |
|---|---|
| scutellarein 7-O-β-D-glucuronate | ChEBI |
| UniProt Name | Source |
|---|---|
| scutellarin | UniProt |
| Citations |
|---|