EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H30N2O4.2Cl |
| Net Charge | 0 |
| Average Mass | 361.310 |
| Monoisotopic Mass | 360.15826 |
| SMILES | C[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)C.[Cl-].[Cl-] |
| InChI | InChI=1S/C14H30N2O4.2ClH/c1-15(2,3)9-11-19-13(17)7-8-14(18)20-12-10-16(4,5)6;;/h7-12H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | YOEWQQVKRJEPAE-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| succinylcholine chloride (anhydrous) (CHEBI:61219) has part succinylcholine (CHEBI:45652) |
| succinylcholine chloride (anhydrous) (CHEBI:61219) has role muscle relaxant (CHEBI:51371) |
| succinylcholine chloride (anhydrous) (CHEBI:61219) is a chloride salt (CHEBI:23114) |
| Incoming Relation(s) |
| succinylcholine chloride dihydrate (CHEBI:61225) has part succinylcholine chloride (anhydrous) (CHEBI:61219) |
| IUPAC Name |
|---|
| 2,2'-[(1,4-dioxobutane-1,4-diyl)bis(oxy)]bis(N,N,N-trimethylethanaminium) dichloride |
| INNs | Source |
|---|---|
| cloruro de suxametonio | ChemIDplus |
| suxamethonii chloridum | ChemIDplus |
| suxamethonium chloride | KEGG DRUG |
| Synonyms | Source |
|---|---|
| 2-dimethylaminoethyl succinate dimethochloride | ChemIDplus |
| (2-hydroxyethyl)trimethylammonium chloride succinate | ChemIDplus |
| anhydrous succinylcholine chloride | ChEBI |
| anhydrous succinylcholine dichloride | ChEBI |
| anhydrous succinyldicholine dichloride | ChEBI |
| anhydrous suxamethonium chloride | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D00766 | KEGG DRUG |
| DB00202 | DrugBank |
| Succinylcholine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3922827 | Reaxys |
| CAS:71-27-2 | KEGG DRUG |