EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:45652 - succinylcholine
| Formula | C14H30N2O4 |
| Net Charge | +2 |
| Average Mass | 290.404 |
| Monoisotopic Mass | 290.21946 |
| SMILES | C[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C14H30N2O4/c1-15(2,3)9-11-19-13(17)7-8-14(18)20-12-10-16(4,5)6/h7-12H2,1-6H3/q+2 |
| InChIKey | AXOIZCJOOAYSMI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. neuromuscular agent A drug used for its actions on skeletal muscle. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| succinylcholine (CHEBI:45652) has role drug allergen (CHEBI:88188) |
| succinylcholine (CHEBI:45652) has role muscle relaxant (CHEBI:51371) |
| succinylcholine (CHEBI:45652) has role neuromuscular agent (CHEBI:51372) |
| succinylcholine (CHEBI:45652) is a quaternary ammonium ion (CHEBI:35267) |
| succinylcholine (CHEBI:45652) is a succinate ester (CHEBI:36181) |
| Incoming Relation(s) |
| succinylcholine chloride (anhydrous) (CHEBI:61219) has part succinylcholine (CHEBI:45652) |
| IUPAC Name |
|---|
| 2,2'-[(1,4-dioxobutane-1,4-diyl)bis(oxy)]bis(N,N,N-trimethylethanaminium) |
| Synonyms | Source |
|---|---|
| Succinylcholine | KEGG COMPOUND |
| 2,2'-[(1,4-DIOXOBUTANE-1,4-DIYL)BIS(OXY)]BIS(N,N,N-TRIMETHYLETHANAMINIUM) | PDBeChem |
| suxamethonium | ChemIDplus |
| succinic acid, diester with choline | ChemIDplus |
| Dicholine succinate | ChemIDplus |
| Succinocholine | ChemIDplus |
| Citations |
|---|