EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N2S |
| Net Charge | +1 |
| Average Mass | 285.436 |
| Monoisotopic Mass | 285.14200 |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)[NH+](C)C |
| InChI | InChI=1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3/p+1 |
| InChIKey | PWWVAXIEGOYWEE-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| promethazine(1+) (CHEBI:61214) is a ammonium ion derivative (CHEBI:35274) |
| promethazine(1+) (CHEBI:61214) is conjugate acid of promethazine (CHEBI:8461) |
| Incoming Relation(s) |
| promethazine hydrochloride (CHEBI:8462) has part promethazine(1+) (CHEBI:61214) |
| promethazine (CHEBI:8461) is conjugate base of promethazine(1+) (CHEBI:61214) |
| IUPAC Name |
|---|
| N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-aminium |
| Synonyms | Source |
|---|---|
| promethazine cation | ChEBI |
| promethazinium | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4263748 | Reaxys |