EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2S |
| Net Charge | 0 |
| Average Mass | 284.428 |
| Monoisotopic Mass | 284.13472 |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)N(C)C |
| InChI | InChI=1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
| InChIKey | PWWVAXIEGOYWEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| promethazine (CHEBI:8461) has role anti-allergic agent (CHEBI:50857) |
| promethazine (CHEBI:8461) has role anticoronaviral agent (CHEBI:149553) |
| promethazine (CHEBI:8461) has role antiemetic (CHEBI:50919) |
| promethazine (CHEBI:8461) has role antipruritic drug (CHEBI:59683) |
| promethazine (CHEBI:8461) has role H1-receptor antagonist (CHEBI:37955) |
| promethazine (CHEBI:8461) has role local anaesthetic (CHEBI:36333) |
| promethazine (CHEBI:8461) has role sedative (CHEBI:35717) |
| promethazine (CHEBI:8461) is a phenothiazines (CHEBI:38093) |
| promethazine (CHEBI:8461) is a tertiary amine (CHEBI:32876) |
| promethazine (CHEBI:8461) is conjugate base of promethazine(1+) (CHEBI:61214) |
| Incoming Relation(s) |
| promethazine(1+) (CHEBI:61214) is conjugate acid of promethazine (CHEBI:8461) |
| IUPAC Name |
|---|
| N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine |
| INNs | Source |
|---|---|
| promethazine | ChEBI |
| prometazina | ChEBI |
| prométhazine | ChEBI |
| promethazinum | ChEBI |
| Synonyms | Source |
|---|---|
| Promethazine | KEGG COMPOUND |
| 10-(2-Dimethylaminopropyl)phenothiazine | KEGG COMPOUND |
| N,N,α-trimethyl-10H-phenothiazine-10-ethanamine | NIST Chemistry WebBook |
| 10-[2-(dimethylamino)propyl]phenothiazine | NIST Chemistry WebBook |
| (2-dimethylamino-2-methyl)ethyl-N-dibenzoparathiazine | ChemIDplus |
| proazamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07404 | KEGG COMPOUND |
| D00494 | KEGG DRUG |
| DB01069 | DrugBank |
| US2530451 | Patent |
| US2607773 | Patent |
| Promethazine | Wikipedia |
| HMDB0015202 | HMDB |
| LSM-4440 | LINCS |
| 2286 | DrugCentral |