EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8461 - promethazine
| Formula | C17H20N2S |
| Net Charge | 0 |
| Average Mass | 284.428 |
| Monoisotopic Mass | 284.13472 |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)N(C)C |
| InChI | InChI=1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
| InChIKey | PWWVAXIEGOYWEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| promethazine (CHEBI:8461) has role anti-allergic agent (CHEBI:50857) |
| promethazine (CHEBI:8461) has role anticoronaviral agent (CHEBI:149553) |
| promethazine (CHEBI:8461) has role antiemetic (CHEBI:50919) |
| promethazine (CHEBI:8461) has role antipruritic drug (CHEBI:59683) |
| promethazine (CHEBI:8461) has role H1-receptor antagonist (CHEBI:37955) |
| promethazine (CHEBI:8461) has role local anaesthetic (CHEBI:36333) |
| promethazine (CHEBI:8461) has role sedative (CHEBI:35717) |
| promethazine (CHEBI:8461) is a phenothiazines (CHEBI:38093) |
| promethazine (CHEBI:8461) is a tertiary amine (CHEBI:32876) |
| promethazine (CHEBI:8461) is conjugate base of promethazine(1+) (CHEBI:61214) |
| Incoming Relation(s) |
| promethazine(1+) (CHEBI:61214) is conjugate acid of promethazine (CHEBI:8461) |
| IUPAC Name |
|---|
| N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine |
| INNs | Source |
|---|---|
| promethazine | ChEBI |
| prometazina | ChEBI |
| prométhazine | ChEBI |
| promethazinum | ChEBI |
| Synonyms | Source |
|---|---|
| Promethazine | KEGG COMPOUND |
| 10-(2-Dimethylaminopropyl)phenothiazine | KEGG COMPOUND |
| N,N,α-trimethyl-10H-phenothiazine-10-ethanamine | NIST Chemistry WebBook |
| 10-[2-(dimethylamino)propyl]phenothiazine | NIST Chemistry WebBook |
| (2-dimethylamino-2-methyl)ethyl-N-dibenzoparathiazine | ChemIDplus |
| proazamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07404 | KEGG COMPOUND |
| D00494 | KEGG DRUG |
| DB01069 | DrugBank |
| US2530451 | Patent |
| US2607773 | Patent |
| Promethazine | Wikipedia |
| HMDB0015202 | HMDB |
| LSM-4440 | LINCS |
| 2286 | DrugCentral |