EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2S |
| Net Charge | 0 |
| Average Mass | 284.428 |
| Monoisotopic Mass | 284.13472 |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)N(C)C |
| InChI | InChI=1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
| InChIKey | PWWVAXIEGOYWEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| promethazine (CHEBI:8461) has role analgesic (CHEBI:35480) |
| promethazine (CHEBI:8461) has role anti-allergic agent (CHEBI:50857) |
| promethazine (CHEBI:8461) has role anticoronaviral agent (CHEBI:149553) |
| promethazine (CHEBI:8461) has role antidepressant (CHEBI:35469) |
| promethazine (CHEBI:8461) has role antiemetic (CHEBI:50919) |
| promethazine (CHEBI:8461) has role antipruritic drug (CHEBI:59683) |
| promethazine (CHEBI:8461) has role antipsychotic agent (CHEBI:35476) |
| promethazine (CHEBI:8461) has role anxiolytic drug (CHEBI:35474) |
| promethazine (CHEBI:8461) has role gastrointestinal drug (CHEBI:55324) |
| promethazine (CHEBI:8461) has role H1-receptor antagonist (CHEBI:37955) |
| promethazine (CHEBI:8461) has role local anaesthetic (CHEBI:36333) |
| promethazine (CHEBI:8461) has role sedative (CHEBI:35717) |
| promethazine (CHEBI:8461) is a phenothiazines (CHEBI:38093) |
| promethazine (CHEBI:8461) is a tertiary amine (CHEBI:32876) |
| promethazine (CHEBI:8461) is conjugate base of promethazine(1+) (CHEBI:61214) |
| Incoming Relation(s) |
| promethazine(1+) (CHEBI:61214) is conjugate acid of promethazine (CHEBI:8461) |
| IUPAC Name |
|---|
| N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine |
| INNs | Source |
|---|---|
| prometazina | ChEBI |
| promethazine | ChEBI |
| prométhazine | ChEBI |
| promethazinum | ChEBI |
| Synonyms | Source |
|---|---|
| 10-(2-Dimethylaminopropyl)phenothiazine | KEGG COMPOUND |
| 10-[2-(dimethylamino)propyl]phenothiazine | NIST Chemistry WebBook |
| (2-dimethylamino-2-methyl)ethyl-N-dibenzoparathiazine | ChemIDplus |
| Dimapp | ChEMBL |
| N-(2'-dimethylamino-2'-methyl)ethylphenothiazine | ChemIDplus |
| N,N,α-trimethyl-10H-phenothiazine-10-ethanamine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 2286 | DrugCentral |
| C07404 | KEGG COMPOUND |
| D00494 | KEGG DRUG |
| DB01069 | DrugBank |
| HMDB0015202 | HMDB |
| LSM-4440 | LINCS |
| Promethazine | Wikipedia |
| US2530451 | Patent |
| US2607773 | Patent |
| Citations |
|---|