EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8461 - promethazine
| Formula | C17H20N2S |
| Net Charge | 0 |
| Average Mass | 284.428 |
| Monoisotopic Mass | 284.13472 |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)N(C)C |
| InChI | InChI=1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
| InChIKey | PWWVAXIEGOYWEE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. anti-allergic agent A drug used to treat allergic reactions. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| promethazine (CHEBI:8461) has role analgesic (CHEBI:35480) |
| promethazine (CHEBI:8461) has role anti-allergic agent (CHEBI:50857) |
| promethazine (CHEBI:8461) has role anticoronaviral agent (CHEBI:149553) |
| promethazine (CHEBI:8461) has role antidepressant (CHEBI:35469) |
| promethazine (CHEBI:8461) has role antiemetic (CHEBI:50919) |
| promethazine (CHEBI:8461) has role antipruritic drug (CHEBI:59683) |
| promethazine (CHEBI:8461) has role antipsychotic agent (CHEBI:35476) |
| promethazine (CHEBI:8461) has role anxiolytic drug (CHEBI:35474) |
| promethazine (CHEBI:8461) has role gastrointestinal drug (CHEBI:55324) |
| promethazine (CHEBI:8461) has role H1-receptor antagonist (CHEBI:37955) |
| promethazine (CHEBI:8461) has role local anaesthetic (CHEBI:36333) |
| promethazine (CHEBI:8461) has role sedative (CHEBI:35717) |
| promethazine (CHEBI:8461) is a phenothiazines (CHEBI:38093) |
| promethazine (CHEBI:8461) is a tertiary amine (CHEBI:32876) |
| promethazine (CHEBI:8461) is conjugate base of promethazine(1+) (CHEBI:61214) |
| Incoming Relation(s) |
| promethazine(1+) (CHEBI:61214) is conjugate acid of promethazine (CHEBI:8461) |
| IUPAC Name |
|---|
| N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine |
| INNs | Source |
|---|---|
| prometazina | ChEBI |
| promethazine | ChEBI |
| prométhazine | ChEBI |
| promethazinum | ChEBI |
| Synonyms | Source |
|---|---|
| 10-(2-Dimethylaminopropyl)phenothiazine | KEGG COMPOUND |
| 10-[2-(dimethylamino)propyl]phenothiazine | NIST Chemistry WebBook |
| (2-dimethylamino-2-methyl)ethyl-N-dibenzoparathiazine | ChemIDplus |
| Dimapp | ChEMBL |
| N-(2'-dimethylamino-2'-methyl)ethylphenothiazine | ChemIDplus |
| N,N,α-trimethyl-10H-phenothiazine-10-ethanamine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 2286 | DrugCentral |
| C07404 | KEGG COMPOUND |
| D00494 | KEGG DRUG |
| DB01069 | DrugBank |
| HMDB0015202 | HMDB |
| LSM-4440 | LINCS |
| Promethazine | Wikipedia |
| US2530451 | Patent |
| US2607773 | Patent |
| Citations |
|---|