EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:8462 - promethazine hydrochloride
| Formula | C17H20N2S.HCl |
| Net Charge | 0 |
| Average Mass | 320.889 |
| Monoisotopic Mass | 320.11140 |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)N(C)C.Cl |
| InChI | InChI=1S/C17H20N2S.ClH/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19;/h4-11,13H,12H2,1-3H3;1H |
| InChIKey | XXPDBLUZJRXNNZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). anti-allergic agent A drug used to treat allergic reactions. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| promethazine hydrochloride (CHEBI:8462) has part promethazine(1+) (CHEBI:61214) |
| promethazine hydrochloride (CHEBI:8462) has role anti-allergic agent (CHEBI:50857) |
| promethazine hydrochloride (CHEBI:8462) has role anticoronaviral agent (CHEBI:149553) |
| promethazine hydrochloride (CHEBI:8462) has role antiemetic (CHEBI:50919) |
| promethazine hydrochloride (CHEBI:8462) has role antipruritic drug (CHEBI:59683) |
| promethazine hydrochloride (CHEBI:8462) has role geroprotector (CHEBI:176497) |
| promethazine hydrochloride (CHEBI:8462) has role H1-receptor antagonist (CHEBI:37955) |
| promethazine hydrochloride (CHEBI:8462) has role local anaesthetic (CHEBI:36333) |
| promethazine hydrochloride (CHEBI:8462) has role sedative (CHEBI:35717) |
| promethazine hydrochloride (CHEBI:8462) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 10-(2-Dimethylamino-1-propyl)phenothiazine hydrochloride | ChemIDplus |
| (+-)-10-(2-(Dimethylamino)propyl)phenothiazine monohydrochloride | ChemIDplus |
| 10-(3-Dimethylaminoisopropyl)phenothiazine hydrochloride | ChemIDplus |
| N-(2'-dimethylamino-2'-methyl)ethylphenothiazine hydrochloride | ChemIDplus |
| N-(2-dimethylaminopropyl-1)phenothiazine hydrochloride | ChemIDplus |
| promethazine HCl | ChemIDplus |
| Brand Names | Source |
|---|---|
| Fenergan | DrugBank |
| Phenergan | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D00480 | KEGG DRUG |
| DBSALT000427 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4166397 | Reaxys |
| CAS:58-33-3 | ChemIDplus |
| Citations |
|---|