EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2S.HCl |
| Net Charge | 0 |
| Average Mass | 320.889 |
| Monoisotopic Mass | 320.11140 |
| SMILES | CC(CN1c2ccccc2Sc2ccccc21)N(C)C.Cl |
| InChI | InChI=1S/C17H20N2S.ClH/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19;/h4-11,13H,12H2,1-3H3;1H |
| InChIKey | XXPDBLUZJRXNNZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| promethazine hydrochloride (CHEBI:8462) has part promethazine(1+) (CHEBI:61214) |
| promethazine hydrochloride (CHEBI:8462) has role anti-allergic agent (CHEBI:50857) |
| promethazine hydrochloride (CHEBI:8462) has role anticoronaviral agent (CHEBI:149553) |
| promethazine hydrochloride (CHEBI:8462) has role antiemetic (CHEBI:50919) |
| promethazine hydrochloride (CHEBI:8462) has role antipruritic drug (CHEBI:59683) |
| promethazine hydrochloride (CHEBI:8462) has role geroprotector (CHEBI:176497) |
| promethazine hydrochloride (CHEBI:8462) has role H1-receptor antagonist (CHEBI:37955) |
| promethazine hydrochloride (CHEBI:8462) has role local anaesthetic (CHEBI:36333) |
| promethazine hydrochloride (CHEBI:8462) has role sedative (CHEBI:35717) |
| promethazine hydrochloride (CHEBI:8462) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine hydrochloride |
| Synonyms | Source |
|---|---|
| 10-(2-Dimethylamino-1-propyl)phenothiazine hydrochloride | ChemIDplus |
| (+-)-10-(2-(Dimethylamino)propyl)phenothiazine monohydrochloride | ChemIDplus |
| 10-(3-Dimethylaminoisopropyl)phenothiazine hydrochloride | ChemIDplus |
| N-(2'-dimethylamino-2'-methyl)ethylphenothiazine hydrochloride | ChemIDplus |
| N-(2-dimethylaminopropyl-1)phenothiazine hydrochloride | ChemIDplus |
| promethazine HCl | ChemIDplus |
| Brand Names | Source |
|---|---|
| Fenergan | DrugBank |
| Phenergan | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| D00480 | KEGG DRUG |
| DBSALT000427 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4166397 | Reaxys |
| CAS:58-33-3 | ChemIDplus |
| Citations |
|---|