EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O2 |
| Net Charge | +2 |
| Average Mass | 354.494 |
| Monoisotopic Mass | 354.22963 |
| SMILES | CCOC(=O)C1(c2ccccc2)CC[NH+](CCc2ccc([NH3+])cc2)CC1 |
| InChI | InChI=1S/C22H28N2O2/c1-2-26-21(25)22(19-6-4-3-5-7-19)13-16-24(17-14-22)15-12-18-8-10-20(23)11-9-18/h3-11H,2,12-17,23H2,1H3/p+2 |
| InChIKey | LKYQLAWMNBFNJT-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anileridine(2+) (CHEBI:61207) is a piperidinium ion (CHEBI:48633) |
| anileridine(2+) (CHEBI:61207) is conjugate acid of anileridine (CHEBI:61203) |
| Incoming Relation(s) |
| anileridine dihydrochloride (CHEBI:61208) has part anileridine(2+) (CHEBI:61207) |
| anileridine (CHEBI:61203) is conjugate base of anileridine(2+) (CHEBI:61207) |
| IUPAC Name |
|---|
| 1-[2-(4-ammoniophenyl)ethyl]-4-(ethoxycarbonyl)-4-phenylpiperidinium |
| Synonyms | Source |
|---|---|
| ethyl 1-[2-(4-ammoniophenyl)ethyl]-4-phenylpiperidinium-4-carboxylate | ChEBI |
| ethyl 1-(4-aminophenethyl)-4-phenylisonipecotate(2+) | ChEBI |
| N-β-(p-aminophenyl)ethylnormeperidine(2+) | ChEBI |
| N-(β-(p-aminophenyl)ethyl)-4-phenyl-4-carbethoxypiperidine(2+) | ChEBI |