EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O2.2HCl |
| Net Charge | 0 |
| Average Mass | 425.400 |
| Monoisotopic Mass | 424.16843 |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCc2ccc(N)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C22H28N2O2.2ClH/c1-2-26-21(25)22(19-6-4-3-5-7-19)13-16-24(17-14-22)15-12-18-8-10-20(23)11-9-18;;/h3-11H,2,12-17,23H2,1H3;2*1H |
| InChIKey | ZYTHLJLPPSSDIP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anileridine dihydrochloride (CHEBI:61208) has part anileridine(2+) (CHEBI:61207) |
| anileridine dihydrochloride (CHEBI:61208) has role opioid analgesic (CHEBI:35482) |
| anileridine dihydrochloride (CHEBI:61208) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| ethyl 1-[2-(4-aminophenyl)ethyl]-4-phenylpiperidine-4-carboxylate dihydrochloride |
| Synonyms | Source |
|---|---|
| 1-[2-(4-ammoniophenyl)ethyl]-4-(ethoxycarbonyl)-4-phenylpiperidinium dichloride | IUPAC |
| N-(β-(p-aminophenyl)ethyl)-4-phenyl-4-carbethoxypiperidine dihydrochloride | ChemIDplus |
| ethyl 1-(4-aminophenethyl)-4-phenylisonipecotate dihydrochloride | ChemIDplus |
| anileridine 2HCl | ChEBI |
| anileridine hydrochloride | ChemIDplus |
| ethyl 1-(p-aminophenethyl)-4-phenylisonipecotate dihydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Leritine | ChemIDplus |