EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28N2O2 |
| Net Charge | 0 |
| Average Mass | 352.478 |
| Monoisotopic Mass | 352.21508 |
| SMILES | CCOC(=O)C1(c2ccccc2)CCN(CCc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C22H28N2O2/c1-2-26-21(25)22(19-6-4-3-5-7-19)13-16-24(17-14-22)15-12-18-8-10-20(23)11-9-18/h3-11H,2,12-17,23H2,1H3 |
| InChIKey | LKYQLAWMNBFNJT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. opioid receptor agonist An agent that selectively binds to and activates an opioid receptor. |
| Applications: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. opioid receptor agonist An agent that selectively binds to and activates an opioid receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anileridine (CHEBI:61203) has functional parent N-[2-(4-aminophenyl)ethyl]-4-phenylisonipecotic acid (CHEBI:61209) |
| anileridine (CHEBI:61203) has role opioid analgesic (CHEBI:35482) |
| anileridine (CHEBI:61203) has role opioid receptor agonist (CHEBI:60606) |
| anileridine (CHEBI:61203) is a ethyl ester (CHEBI:23990) |
| anileridine (CHEBI:61203) is a piperidinecarboxylate ester (CHEBI:48630) |
| anileridine (CHEBI:61203) is a substituted aniline (CHEBI:48975) |
| anileridine (CHEBI:61203) is conjugate base of anileridine(2+) (CHEBI:61207) |
| Incoming Relation(s) |
| anileridine(2+) (CHEBI:61207) is conjugate acid of anileridine (CHEBI:61203) |
| IUPAC Name |
|---|
| ethyl 1-[2-(4-aminophenyl)ethyl]-4-phenylpiperidine-4-carboxylate |
| INNs | Source |
|---|---|
| anileridina | ChemIDplus |
| anileridine | ChemIDplus |
| anileridinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-[2-(4-aminophenyl)ethyl]-4-phenyl-4-piperidinecarboxlic acid ethyl ester | NIST Chemistry WebBook |
| N-(β-(p-aminophenyl)ethyl)-4-phenyl-4-carbethoxypiperidine | ChemIDplus |
| N-β-(p-aminophenyl)ethylnormeperidine | ChemIDplus |
| ethyl 1-(2-(4-aminophenyl)ethyl)-4-phenyl-4-piperidinecarboxylate | ChemIDplus |
| ethyl 1-(4-aminophenethyl)-4-phenylisonipecotate | ChemIDplus |
| ethyl 1-(p-aminophenethyl)-4-phenylisonipecotate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 220 | DrugCentral |
| Anileridine | Wikipedia |
| D02941 | KEGG DRUG |
| DB00913 | DrugBank |
| HMDB0015049 | HMDB |
| US2966490 | Patent |
| Citations |
|---|