EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N2O2 |
| Net Charge | 0 |
| Average Mass | 324.424 |
| Monoisotopic Mass | 324.18378 |
| SMILES | Nc1ccc(CCN2CCC(C(=O)O)(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O2/c21-18-8-6-16(7-9-18)10-13-22-14-11-20(12-15-22,19(23)24)17-4-2-1-3-5-17/h1-9H,10-15,21H2,(H,23,24) |
| InChIKey | MECKFKIUTIDCPC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(4-aminophenyl)ethyl]-4-phenylisonipecotic acid (CHEBI:61209) is a amino acid (CHEBI:33709) |
| N-[2-(4-aminophenyl)ethyl]-4-phenylisonipecotic acid (CHEBI:61209) is a piperidinemonocarboxylic acid (CHEBI:26148) |
| N-[2-(4-aminophenyl)ethyl]-4-phenylisonipecotic acid (CHEBI:61209) is a substituted aniline (CHEBI:48975) |
| Incoming Relation(s) |
| anileridine (CHEBI:61203) has functional parent N-[2-(4-aminophenyl)ethyl]-4-phenylisonipecotic acid (CHEBI:61209) |
| IUPAC Name |
|---|
| 1-[2-(4-aminophenyl)ethyl]-4-phenylpiperidine-4-carboxylic acid |
| Synonym | Source |
|---|---|
| 1-[2-(4-aminophenyl)ethyl]-4-phenylisonipecotic acid | ChEBI |