EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H35ClN2 |
| Net Charge | +2 |
| Average Mass | 435.055 |
| Monoisotopic Mass | 434.24778 |
| SMILES | CC(C)(C)c1ccc(C[NH+]2CC[NH+](C(c3ccccc3)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3/p+2 |
| InChIKey | MOYGZHXDRJNJEP-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buclizine(2+) (CHEBI:61192) is a ammonium ion derivative (CHEBI:35274) |
| buclizine(2+) (CHEBI:61192) is conjugate acid of buclizine (CHEBI:3205) |
| Incoming Relation(s) |
| buclizine dihydrochloride (CHEBI:61193) has part buclizine(2+) (CHEBI:61192) |
| buclizine (CHEBI:3205) is conjugate base of buclizine(2+) (CHEBI:61192) |
| IUPAC Name |
|---|
| 1-(4-tert-butylbenzyl)-4-[(4-chlorophenyl)(phenyl)methyl]piperazinediium |