EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H33ClN2.2HCl |
| Net Charge | 0 |
| Average Mass | 505.961 |
| Monoisotopic Mass | 504.18658 |
| SMILES | CC(C)(C)c1ccc(CN2CCN(C(c3ccccc3)c3ccc(Cl)cc3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C28H33ClN2.2ClH/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24;;/h4-16,27H,17-21H2,1-3H3;2*1H |
| InChIKey | SDBHDSZKNVDKNU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buclizine dihydrochloride (CHEBI:61193) has part buclizine(2+) (CHEBI:61192) |
| buclizine dihydrochloride (CHEBI:61193) has role antiemetic (CHEBI:50919) |
| buclizine dihydrochloride (CHEBI:61193) has role central nervous system depressant (CHEBI:35488) |
| buclizine dihydrochloride (CHEBI:61193) has role cholinergic antagonist (CHEBI:48873) |
| buclizine dihydrochloride (CHEBI:61193) has role histamine antagonist (CHEBI:37956) |
| buclizine dihydrochloride (CHEBI:61193) has role local anaesthetic (CHEBI:36333) |
| buclizine dihydrochloride (CHEBI:61193) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-(4-tert-butylbenzyl)-4-[(4-chlorophenyl)(phenyl)methyl]piperazine dihydrochloride |
| Synonyms | Source |
|---|---|
| 1-(4-tert-butylbenzyl)-4-[(4-chlorophenyl)(phenyl)methyl]piperazinediium dichloride | IUPAC |
| 1-(p-chlorobenzhydryl)-4-(p-t-butylbenzyl)diethylenediamine dihydrochloride | ChemIDplus |
| 1-(p-tert-butylbenzyl)-4-(p-chloro-α-phenylbenzyl)piperazine dihydrochloride | ChemIDplus |
| buclizine 2HCl | ChEBI |
| buclizine hydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| BUCLADIN-S | ChEBI |