EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H33ClN2 |
| Net Charge | 0 |
| Average Mass | 433.039 |
| Monoisotopic Mass | 432.23323 |
| SMILES | CC(C)(C)c1ccc(CN2CCN(C(c3ccccc3)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H33ClN2/c1-28(2,3)25-13-9-22(10-14-25)21-30-17-19-31(20-18-30)27(23-7-5-4-6-8-23)24-11-15-26(29)16-12-24/h4-16,27H,17-21H2,1-3H3 |
| InChIKey | MOYGZHXDRJNJEP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Applications: | histamine antagonist Histamine antagonists are the drugs that bind to but do not activate histamine receptors, thereby blocking the actions of histamine or histamine agonists. cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buclizine (CHEBI:3205) has role antiemetic (CHEBI:50919) |
| buclizine (CHEBI:3205) has role central nervous system depressant (CHEBI:35488) |
| buclizine (CHEBI:3205) has role cholinergic antagonist (CHEBI:48873) |
| buclizine (CHEBI:3205) has role histamine antagonist (CHEBI:37956) |
| buclizine (CHEBI:3205) has role local anaesthetic (CHEBI:36333) |
| buclizine (CHEBI:3205) is a N-alkylpiperazine (CHEBI:46845) |
| buclizine (CHEBI:3205) is a monochlorobenzenes (CHEBI:83403) |
| buclizine (CHEBI:3205) is conjugate base of buclizine(2+) (CHEBI:61192) |
| Incoming Relation(s) |
| buclizine(2+) (CHEBI:61192) is conjugate acid of buclizine (CHEBI:3205) |
| IUPAC Name |
|---|
| 1-(4-tert-butylbenzyl)-4-[(4-chlorophenyl)(phenyl)methyl]piperazine |
| INNs | Source |
|---|---|
| buclizina | WHO MedNet |
| buclizine | ChemIDplus |
| buclizine | WHO MedNet |
| buclizinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(p-tert-Butylbenzyl)-4-(4-chloro-alpha-phenylbenzyl)piperazine | ChemIDplus |
| Buclizine | KEGG COMPOUND |
| Citations |
|---|