EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6NO3 |
| Net Charge | -1 |
| Average Mass | 152.129 |
| Monoisotopic Mass | 152.03532 |
| SMILES | NC1C(=O)C=CC=C1C(=O)[O-] |
| InChI | InChI=1S/C7H7NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,6H,8H2,(H,10,11)/p-1 |
| InChIKey | RVCNGLBZLLWEIQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) is a 4-oxo monocarboxylic acid anion (CHEBI:35974) |
| 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) is a oxo monocarboxylic acid anion (CHEBI:35902) |
| 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) is conjugate base of 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) |
| 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) is tautomer of 3-hydroxyanthranilate (CHEBI:36559) |
| Incoming Relation(s) |
| 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) is conjugate acid of 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) |
| 3-hydroxyanthranilate (CHEBI:36559) is tautomer of 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) |
| IUPAC Name |
|---|
| 6-amino-5-oxocyclohexa-1,3-diene-1-carboxylate |