EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:61149 - 2,3-dihydro-3-oxoanthranilic acid
| Formula | C7H7NO3 |
| Net Charge | 0 |
| Average Mass | 153.137 |
| Monoisotopic Mass | 153.04259 |
| SMILES | NC1C(=O)C=CC=C1C(=O)O |
| InChI | InChI=1S/C7H7NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,6H,8H2,(H,10,11) |
| InChIKey | RVCNGLBZLLWEIQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) is a amino acid (CHEBI:33709) |
| 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) is a oxo carboxylic acid (CHEBI:25754) |
| 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) is conjugate acid of 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) |
| 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) is tautomer of 3-hydroxyanthranilic acid (CHEBI:15793) |
| Incoming Relation(s) |
| 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) is conjugate base of 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) |
| 3-hydroxyanthranilic acid (CHEBI:15793) is tautomer of 2,3-dihydro-3-oxoanthranilic acid (CHEBI:61149) |
| IUPAC Name |
|---|
| 6-amino-5-oxocyclohexa-1,3-diene-1-carboxylic acid |