EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:36559 - 3-hydroxyanthranilate
| Formula | C7H6NO3 |
| Net Charge | -1 |
| Average Mass | 152.129 |
| Monoisotopic Mass | 152.03532 |
| SMILES | Nc1c(O)cccc1C(=O)[O-] |
| InChI | InChI=1S/C7H7NO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,9H,8H2,(H,10,11)/p-1 |
| InChIKey | WJXSWCUQABXPFS-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyanthranilate (CHEBI:36559) has functional parent anthranilate (CHEBI:16567) |
| 3-hydroxyanthranilate (CHEBI:36559) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 3-hydroxyanthranilate (CHEBI:36559) has role human metabolite (CHEBI:77746) |
| 3-hydroxyanthranilate (CHEBI:36559) has role mouse metabolite (CHEBI:75771) |
| 3-hydroxyanthranilate (CHEBI:36559) is a aminobenzoate (CHEBI:22494) |
| 3-hydroxyanthranilate (CHEBI:36559) is a aromatic amino-acid anion (CHEBI:63473) |
| 3-hydroxyanthranilate (CHEBI:36559) is a hydroxybenzoate (CHEBI:24675) |
| 3-hydroxyanthranilate (CHEBI:36559) is conjugate base of 3-hydroxyanthranilic acid (CHEBI:15793) |
| 3-hydroxyanthranilate (CHEBI:36559) is tautomer of 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) |
| Incoming Relation(s) |
| 3-hydroxyanthranilic acid (CHEBI:15793) is conjugate acid of 3-hydroxyanthranilate (CHEBI:36559) |
| 2,3-dihydro-3-oxoanthranilate (CHEBI:61150) is tautomer of 3-hydroxyanthranilate (CHEBI:36559) |
| IUPAC Name |
|---|
| 2-amino-3-hydroxybenzoate |
| UniProt Name | Source |
|---|---|
| 3-hydroxyanthranilate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00632 | KEGG COMPOUND |
| 3-HYDROXY-ANTHRANILATE | MetaCyc |