EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N4O3 |
| Net Charge | 0 |
| Average Mass | 176.176 |
| Monoisotopic Mass | 176.09094 |
| SMILES | N=C(N)NOCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H12N4O3/c6-3(4(10)11)1-2-12-9-5(7)8/h3H,1-2,6H2,(H,10,11)(H4,7,8,9)/t3-/m0/s1 |
| InChIKey | FSBIGDSBMBYOPN-VKHMYHEASA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-canavanine zwitterion (CHEBI:405237) is a amino-acid zwitterion (CHEBI:35238) |
| L-canavanine zwitterion (CHEBI:405237) is conjugate base of L-canavanine(1+) (CHEBI:78902) |
| L-canavanine zwitterion (CHEBI:405237) is tautomer of L-canavanine (CHEBI:609827) |
| Incoming Relation(s) |
| L-canavanine(1+) (CHEBI:78902) is conjugate acid of L-canavanine zwitterion (CHEBI:405237) |
| L-canavanine (CHEBI:609827) is tautomer of L-canavanine zwitterion (CHEBI:405237) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-(carbamimidamidooxy)butanoate |
| Synonyms | Source |
|---|---|
| (2S)-2-ammonio-4-(carbamimidamidooxy)butanoate | IUPAC |
| L-Canavanine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| CANAVANINE | MetaCyc |