EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO5 |
| Net Charge | 0 |
| Average Mass | 149.102 |
| Monoisotopic Mass | 149.03242 |
| SMILES | N[C@@H](C(=O)O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/t1-,2+/m1/s1 |
| InChIKey | YYLQUHNPNCGKJQ-NCGGTJAESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-hydroxy-D-aspartic acid (CHEBI:60893) is a 3-hydroxy-D-aspartic acid (CHEBI:60887) |
| (3S)-3-hydroxy-D-aspartic acid (CHEBI:60893) is conjugate acid of (3S)-3-hydroxy-D-aspartate(1−) (CHEBI:60894) |
| (3S)-3-hydroxy-D-aspartic acid (CHEBI:60893) is enantiomer of (3R)-3-hydroxy-L-aspartic acid (CHEBI:17576) |
| Incoming Relation(s) |
| (3S)-3-hydroxy-D-aspartate(1−) (CHEBI:60894) is conjugate base of (3S)-3-hydroxy-D-aspartic acid (CHEBI:60893) |
| (3R)-3-hydroxy-L-aspartic acid (CHEBI:17576) is enantiomer of (3S)-3-hydroxy-D-aspartic acid (CHEBI:60893) |
| IUPAC Name |
|---|
| (3S)-3-hydroxy-D-aspartic acid |
| Synonyms | Source |
|---|---|
| (2R,3S)-2-amino-3-hydroxybutanedioic acid | IUPAC |
| (2R,3S)-2-amino-3-hydroxysuccinic acid | ChEBI |
| erythro-3-hydroxy-D-aspartic acid | ChEBI |
| erythro-β-hydroxy-D-aspartic acid | ChEBI |
| D-erythro-3-hydroxyaspartic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-12739 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2046209 | Beilstein |
| Citations |
|---|