EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO5 |
| Net Charge | 0 |
| Average Mass | 149.102 |
| Monoisotopic Mass | 149.03242 |
| SMILES | N[C@@H](C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/t1-,2?/m1/s1 |
| InChIKey | YYLQUHNPNCGKJQ-ZILXKATJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-D-aspartic acid (CHEBI:60887) has role fungal metabolite (CHEBI:76946) |
| 3-hydroxy-D-aspartic acid (CHEBI:60887) is a D-aspartic acid derivative (CHEBI:83979) |
| 3-hydroxy-D-aspartic acid (CHEBI:60887) is a D-α-amino acid (CHEBI:16733) |
| 3-hydroxy-D-aspartic acid (CHEBI:60887) is a 3-hydroxyaspartic acid (CHEBI:83981) |
| 3-hydroxy-D-aspartic acid (CHEBI:60887) is enantiomer of 3-hydroxy-L-aspartic acid (CHEBI:48423) |
| Incoming Relation(s) |
| (3R)-3-hydroxy-D-aspartic acid (CHEBI:60897) is a 3-hydroxy-D-aspartic acid (CHEBI:60887) |
| (3S)-3-hydroxy-D-aspartic acid (CHEBI:60893) is a 3-hydroxy-D-aspartic acid (CHEBI:60887) |
| 3-hydroxy-L-aspartic acid (CHEBI:48423) is enantiomer of 3-hydroxy-D-aspartic acid (CHEBI:60887) |
| IUPAC Name |
|---|
| 3-hydroxy-D-aspartic acid |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-hydroxybutanedioic acid | IUPAC |
| (2R)-2-amino-3-hydroxysuccinic acid | ChEBI |