EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6NO5 |
| Net Charge | -1 |
| Average Mass | 148.094 |
| Monoisotopic Mass | 148.02515 |
| SMILES | [NH3+][C@@H](C(=O)[O-])[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/p-1/t1-,2+/m1/s1 |
| InChIKey | YYLQUHNPNCGKJQ-NCGGTJAESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-hydroxy-D-aspartate(1−) (CHEBI:60894) is a D-α-amino acid anion (CHEBI:60895) |
| (3S)-3-hydroxy-D-aspartate(1−) (CHEBI:60894) is a dicarboxylic acid anion (CHEBI:35693) |
| (3S)-3-hydroxy-D-aspartate(1−) (CHEBI:60894) is conjugate base of (3S)-3-hydroxy-D-aspartic acid (CHEBI:60893) |
| (3S)-3-hydroxy-D-aspartate(1−) (CHEBI:60894) is enantiomer of (3R)-3-hydroxy-L-aspartate(1−) (CHEBI:58196) |
| Incoming Relation(s) |
| (3S)-3-hydroxy-D-aspartic acid (CHEBI:60893) is conjugate acid of (3S)-3-hydroxy-D-aspartate(1−) (CHEBI:60894) |
| (3R)-3-hydroxy-L-aspartate(1−) (CHEBI:58196) is enantiomer of (3S)-3-hydroxy-D-aspartate(1−) (CHEBI:60894) |
| IUPAC Name |
|---|
| (2R,3S)-2-ammonio-3-hydroxybutanedioate |
| Synonyms | Source |
|---|---|
| (3S)-3-hydroxy-D-aspartate | ChEBI |
| erythro-3-hydroxy-D-aspartate | ChEBI |
| erythro-β-hydroxy-D-aspartate | ChEBI |
| D-erythro-3-hydroxyaspartate | ChEBI |
| UniProt Name | Source |
|---|---|
| (3S)-3-hydroxy-D-aspartate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12739 | MetaCyc |
| Citations |
|---|