EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO5 |
| Net Charge | 0 |
| Average Mass | 149.102 |
| Monoisotopic Mass | 149.03242 |
| SMILES | NC(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10) |
| InChIKey | YYLQUHNPNCGKJQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyaspartic acid (CHEBI:83981) is a amino dicarboxylic acid (CHEBI:36164) |
| 3-hydroxyaspartic acid (CHEBI:83981) is a aspartic acid derivative (CHEBI:22661) |
| 3-hydroxyaspartic acid (CHEBI:83981) is a C4-dicarboxylic acid (CHEBI:66873) |
| 3-hydroxyaspartic acid (CHEBI:83981) is a hydroxy-amino acid (CHEBI:24662) |
| Incoming Relation(s) |
| 3-hydroxy-D-aspartic acid (CHEBI:60887) is a 3-hydroxyaspartic acid (CHEBI:83981) |
| 3-hydroxy-L-aspartic acid (CHEBI:48423) is a 3-hydroxyaspartic acid (CHEBI:83981) |
| 3-hydroxyaspartic acid residue (CHEBI:142054) is substituent group from 3-hydroxyaspartic acid (CHEBI:83981) |
| Synonyms | Source |
|---|---|
| 3-aminomalic acid | ChEBI |
| β-hydroxyaspartic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:1860-87-3 | ChemIDplus |