EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:60826 - streptothricin acid
| Formula | (C6H12N2O)1-7.C13H24N6O8 |
| Net Charge | 0 |
| Average Mass | 520.544 |
| Monoisotopic Mass | 520.26052 |
| SMILES | [H]NCCC[C@H](N)CC(=O)N[C@@H]1[C@H](O)[C@@H](OC(N)=O)[C@@H](CO)O[C@H]1/N=C1\N[C@]([H])(C(=O)O)[C@@]([H])([C@H](O)CN)N1 |
| InChI | InChI=1S/C19H36N8O9/c20-3-1-2-7(22)4-10(30)24-13-14(31)15(36-18(23)34)9(6-28)35-16(13)27-19-25-11(8(29)5-21)12(26-19)17(32)33/h7-9,11-16,28-29,31H,1-6,20-22H2,(H2,23,34)(H,24,30)(H,32,33)(H2,25,26,27)/t7-,8+,9+,11+,12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | AJUBASUIRHJEOK-AQLSXGMYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptothricin acid (CHEBI:60826) is a N-glycosyl compound (CHEBI:21731) |
| streptothricin acid (CHEBI:60826) is a carbamate ester (CHEBI:23003) |
| streptothricin acid (CHEBI:60826) is a carboxamide (CHEBI:37622) |
| streptothricin acid (CHEBI:60826) is a guanidines (CHEBI:24436) |
| streptothricin acid (CHEBI:60826) is a δ-amino acid (CHEBI:35931) |
| Incoming Relation(s) |
| streptothricin D acid (CHEBI:60830) is a streptothricin acid (CHEBI:60826) |
| streptothricin F acid (CHEBI:60823) is a streptothricin acid (CHEBI:60826) |
| Synonyms | Source |
|---|---|
| streptothricin acids | ChEBI |
| yazumycins acids | ChEBI |
| racemomycin acids | ChEBI |
| yazumycins acid | ChEBI |
| racemomycin acid | ChEBI |