EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36N8O9 |
| Net Charge | 0 |
| Average Mass | 520.544 |
| Monoisotopic Mass | 520.26052 |
| SMILES | [H][C@]1(C(=O)O)N/C(=N/[C@@H]2O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]2NC(=O)C[C@@H](N)CCCN)N[C@]1([H])[C@H](O)CN |
| InChI | InChI=1S/C19H36N8O9/c20-3-1-2-7(22)4-10(30)24-13-14(31)15(36-18(23)34)9(6-28)35-16(13)27-19-25-11(8(29)5-21)12(26-19)17(32)33/h7-9,11-16,28-29,31H,1-6,20-22H2,(H2,23,34)(H,24,30)(H,32,33)(H2,25,26,27)/t7-,8+,9+,11+,12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | AJUBASUIRHJEOK-AQLSXGMYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptothricin F acid (CHEBI:60823) is a streptothricin acid (CHEBI:60826) |
| streptothricin F acid (CHEBI:60823) is conjugate base of streptothricin F acid (pH 7.3) (CHEBI:60838) |
| Incoming Relation(s) |
| streptothricin F acid (pH 7.3) (CHEBI:60838) is conjugate acid of streptothricin F acid (CHEBI:60823) |
| IUPAC Name |
|---|
| N-{(4S,5S)-4-[(1R)-2-amino-1-hydroxyethyl]-5-carboxyimidazolidin-2-ylidene}-4-O-carbamoyl-2-deoxy-2-{[(3S)-3,6-diaminohexanoyl]amino}-β-D-gulopyranosylamine |
| Synonyms | Source |
|---|---|
| yazumycin A acid | ChEBI |
| racemomycin A acid | ChEBI |
| antibiotic S 15-1A acid | ChEBI |
| streptothricin VI acid | ChEBI |
| streptothricin acid | ChEBI |
| Citations |
|---|