EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H60N12O11 |
| Net Charge | 0 |
| Average Mass | 776.894 |
| Monoisotopic Mass | 776.45045 |
| SMILES | [H][C@]1(C(=O)O)N/C(=N/[C@@H]2O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]2NC(=O)C[C@@H](N)CCCNC(=O)C[C@@H](N)CCCNC(=O)C[C@@H](N)CCCN)N[C@]1([H])[C@H](O)CN |
| InChI | InChI=1S/C31H60N12O11/c32-7-1-4-15(34)10-20(46)38-8-2-5-16(35)11-21(47)39-9-3-6-17(36)12-22(48)40-25-26(49)27(54-30(37)52)19(14-44)53-28(25)43-31-41-23(18(45)13-33)24(42-31)29(50)51/h15-19,23-28,44-45,49H,1-14,32-36H2,(H2,37,52)(H,38,46)(H,39,47)(H,40,48)(H,50,51)(H2,41,42,43)/t15-,16-,17-,18+,19+,23+,24-,25+,26-,27-,28+/m0/s1 |
| InChIKey | DLWGZGTWTREZQM-UFFKCXTPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptothricin D acid (CHEBI:60830) is a streptothricin acid (CHEBI:60826) |
| streptothricin D acid (CHEBI:60830) is conjugate base of streptothricin D acid (pH 7.3) (CHEBI:60839) |
| Incoming Relation(s) |
| streptothricin D acid (pH 7.3) (CHEBI:60839) is conjugate acid of streptothricin D acid (CHEBI:60830) |
| IUPAC Name |
|---|
| 2-{[(3S)-3-amino-6-{[(3S)-3-amino-6-{[(3S)-3,6-diaminohexanoyl]amino}hexanoyl]amino}hexanoyl]amino}-N-{(4S,5S)-4-[(1R)-2-amino-1-hydroxyethyl]-5-carboxyimidazolidin-2-ylidene}-4-O-carbamoyl-2-deoxy-β-D-gulopyranosylamine |
| Synonyms | Source |
|---|---|
| antibiotic OP 2C acid | ChEBI |
| racemomycin B acid | ChEBI |
| Citations |
|---|