EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22HgN2O6S |
| Net Charge | 0 |
| Average Mass | 655.094 |
| Monoisotopic Mass | 656.09050 |
| SMILES | [H]C(N[C@H](C(=O)O)C(C)(C)[S][Hg][c]1ccc(C(=O)O)cc1)=C1N=C(Cc2ccccc2)OC1=O |
| InChI | InChI=1S/C16H18N2O4S.C7H5O2.Hg/c1-16(2,23)13(14(19)20)17-9-11-15(21)22-12(18-11)8-10-6-4-3-5-7-10;8-7(9)6-4-2-1-3-5-6;/h3-7,9,13,17,23H,8H2,1-2H3,(H,19,20);2-5H,(H,8,9);/q;;+1/p-1/t13-;;/m1../s1 |
| InChIKey | KJWKVPCQNGYNOT-FFXKMJQXSA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PNCMB (CHEBI:60168) is a arylmercury compound (CHEBI:22648) |
| PNCMB (CHEBI:60168) is a benzylpenicillenic acid (CHEBI:60209) |
| PNCMB (CHEBI:60168) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| {N-[(2-benzyl-5-oxo-1,3-oxazol-4(5H)-ylidene)methyl]-3-(sulfanyl-κS)-L-valinato}(4-carboxyphenyl)mercury |
| Synonyms | Source |
|---|---|
| p-chloromercuribenzoate derivative of benzylpenicillenic acid | ChEBI |
| p-chloromercuribenzoate derivative of penicillenic acid | ChEBI |
| Citations |
|---|