EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29214 - sulfonic acid
| Formula | H2O3S |
| Net Charge | 0 |
| Average Mass | 82.080 |
| Monoisotopic Mass | 81.97246 |
| SMILES | [H]S(=O)(=O)O |
| InChI | InChI=1S/H2O3S/c1-4(2)3/h4H,(H,1,2,3) |
| InChIKey | BDHFUVZGWQCTTF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfonic acid (CHEBI:29214) is a sulfur oxoacid (CHEBI:33402) |
| sulfonic acid (CHEBI:29214) is conjugate acid of sulfonate (CHEBI:33543) |
| sulfonic acid (CHEBI:29214) is tautomer of sulfurous acid (CHEBI:48854) |
| Incoming Relation(s) |
| acetoxysulfonic acid (CHEBI:48979) has functional parent sulfonic acid (CHEBI:29214) |
| sulfonate ester (CHEBI:52474) has functional parent sulfonic acid (CHEBI:29214) |
| sulfonic acid derivative (CHEBI:33552) has functional parent sulfonic acid (CHEBI:29214) |
| 1-(4-sulfophenyl)-3-carboxy-4-amino-5-oxopyrazole (CHEBI:59995) is a sulfonic acid (CHEBI:29214) |
| glutaurine (CHEBI:27694) is a sulfonic acid (CHEBI:29214) |
| sulfonate (CHEBI:33543) is conjugate base of sulfonic acid (CHEBI:29214) |
| sulfo group (CHEBI:29922) is substituent group from sulfonic acid (CHEBI:29214) |
| sulfurous acid (CHEBI:48854) is tautomer of sulfonic acid (CHEBI:29214) |
| IUPAC Names |
|---|
| hydridohydroxidodioxidosulfur |
| sulfonic acid |
| Synonyms | Source |
|---|---|
| HSHO3 | IUPAC |
| [SHO2(OH)] | IUPAC |
| sulphonic acid | ChEBI |
| Sulfonsäure | ChEBI |
| acide sulfonique | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1404640 | Gmelin |