EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11O7 |
| Net Charge | -1 |
| Average Mass | 315.257 |
| Monoisotopic Mass | 315.05103 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc([O-])cc3o2)cc(O)c1O |
| InChI | InChI=1S/C16H12O7/c1-22-14-3-7(2-11(20)16(14)21)12-6-10(19)15-9(18)4-8(17)5-13(15)23-12/h2-6,17-18,20-21H,1H3/p-1 |
| InChIKey | UGPOBASOHYMNAK-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-O-methyltricetin(1−) (CHEBI:60014) is a flavonoid oxoanion (CHEBI:60038) |
| 3'-O-methyltricetin(1−) (CHEBI:60014) is conjugate base of 3'-O-methyltricetin (CHEBI:59976) |
| Incoming Relation(s) |
| 3'-O-methyltricetin (CHEBI:59976) is conjugate acid of 3'-O-methyltricetin(1−) (CHEBI:60014) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-4-oxo-4H-chromen-7-olate |
| UniProt Name | Source |
|---|---|
| 3'-O-methyltricetin | UniProt |