EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6ClN4O2 |
| Net Charge | -1 |
| Average Mass | 213.604 |
| Monoisotopic Mass | 213.01848 |
| SMILES | Cn1c(=O)c2[n-]c(Cl)nc2n(C)c1=O |
| InChI | InChI=1S/C7H7ClN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10,13)/p-1 |
| InChIKey | NBLOJVMYLSLJSB-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-chlorotheophylline(1−) (CHEBI:59778) is a organic nitrogen anion (CHEBI:50335) |
| 8-chlorotheophylline(1−) (CHEBI:59778) is conjugate base of 8-chlorotheophylline (CHEBI:59771) |
| Incoming Relation(s) |
| dimenhydrinate (CHEBI:4604) has part 8-chlorotheophylline(1−) (CHEBI:59778) |
| 8-chlorotheophylline (CHEBI:59771) is conjugate acid of 8-chlorotheophylline(1−) (CHEBI:59778) |
| IUPAC Name |
|---|
| 8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydropurin-7-ide |
| Synonyms | Source |
|---|---|
| 1,3-dimethyl-8-chloroxanthine anion | ChEBI |
| 1,3-dimethyl-8-chloroxanthine(1−) | ChEBI |
| 8-chlorotheophylline anion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3678329 | Reaxys |