EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22NO.C7H6ClN4O2 |
| Net Charge | 0 |
| Average Mass | 469.973 |
| Monoisotopic Mass | 469.18807 |
| SMILES | C[NH+](C)CCOC(c1ccccc1)c1ccccc1.Cn1c(=O)c2[n-]c(Cl)nc2n(C)c1=O |
| InChI | InChI=1S/C17H21NO.C7H7ClN4O2/c1-18(2)13-14-19-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16;1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h3-12,17H,13-14H2,1-2H3;1-2H3,(H,9,10,13) |
| InChIKey | DKHVTDUUNTVKOW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antiemetic A drug used to prevent nausea or vomiting. An antiemetic may act by a wide range of mechanisms: it might affect the medullary control centres (the vomiting centre and the chemoreceptive trigger zone) or affect the peripheral receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimenhydrinate (CHEBI:4604) has part 8-chlorotheophylline(1−) (CHEBI:59778) |
| dimenhydrinate (CHEBI:4604) has part diphenhydramine (CHEBI:4636) |
| dimenhydrinate (CHEBI:4604) has role antiemetic (CHEBI:50919) |
| dimenhydrinate (CHEBI:4604) has role H1-receptor antagonist (CHEBI:37955) |
| dimenhydrinate (CHEBI:4604) is a organic salt (CHEBI:24868) |
| IUPAC Name |
|---|
| 2-(diphenylmethoxy)-N,N-dimethylethanaminium 8-chloro-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydropurin-7-ide |
| INNs | Source |
|---|---|
| dimenhidrinato | ChemIDplus |
| dimenhydrinatum | ChemIDplus |
| dimenhydrinate | ChemIDplus |
| Synonyms | Source |
|---|---|
| diphenhydramine 8-chlorotheophyllinate | ChemIDplus |
| Benzhydryl-β-dimethylaminoethylether 8-chlorotheophylline | ChemIDplus |
| diphenhydramine 8-chlorotheophylline | ChemIDplus |
| (O-benzhydryl(dimethylamino)ethanol) 8-chlorotheophyllinate | ChemIDplus |
| O-benzhydryldimethylaminoethanol 8-chlorotheophyllinate | ChemIDplus |
| β-dimethylaminoethyl benzhydryl ether 1,3-dimethyl-8-chloroxanthine | ChemIDplus |