EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7ClN4O2 |
| Net Charge | 0 |
| Average Mass | 214.612 |
| Monoisotopic Mass | 214.02575 |
| SMILES | Cn1c(=O)c2nc(Cl)nc2n(C)c1=O |
| InChI | InChI=1S/C7H7ClN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10) |
| InChIKey | RYIGNEOBDRVTHA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-chlorotheophylline (CHEBI:59771) has role central nervous system stimulant (CHEBI:35337) |
| 8-chlorotheophylline (CHEBI:59771) is a organochlorine compound (CHEBI:36683) |
| 8-chlorotheophylline (CHEBI:59771) is a purines (CHEBI:26401) |
| 8-chlorotheophylline (CHEBI:59771) is conjugate acid of 8-chlorotheophylline(1−) (CHEBI:59778) |
| Incoming Relation(s) |
| 8-chlorotheophylline(1−) (CHEBI:59778) is conjugate base of 8-chlorotheophylline (CHEBI:59771) |
| IUPAC Name |
|---|
| 8-chloro-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
| Synonyms | Source |
|---|---|
| 1,3-dimethyl-8-chloroxanthine | ChemIDplus |
| 8-chloro-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:203068 | Reaxys |
| CAS:85-18-7 | ChemIDplus |