EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10ClN2O3.K |
| Net Charge | 0 |
| Average Mass | 352.818 |
| Monoisotopic Mass | 352.00170 |
| SMILES | O=C([O-])C1N=C(c2ccccc2)c2cc(Cl)ccc2NC1=O.[K+] |
| InChI | InChI=1S/C16H11ClN2O3.K/c17-10-6-7-12-11(8-10)13(9-4-2-1-3-5-9)19-14(16(21)22)15(20)18-12;/h1-8,14H,(H,18,20)(H,21,22);/q;+1/p-1 |
| InChIKey | ULEUKTXFAJZAAV-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clorazepate monopotassium (CHEBI:59591) has part clorazepic acid anion (CHEBI:59590) |
| clorazepate monopotassium (CHEBI:59591) has role anxiolytic drug (CHEBI:35474) |
| clorazepate monopotassium (CHEBI:59591) has role prodrug (CHEBI:50266) |
| clorazepate monopotassium (CHEBI:59591) is a potassium salt (CHEBI:26218) |
| Incoming Relation(s) |
| dipotassium clorazepate (CHEBI:3762) has part clorazepate monopotassium (CHEBI:59591) |
| IUPAC Name |
|---|
| potassium 7-chloro-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepine-3-carboxylate |
| Synonyms | Source |
|---|---|
| potassium 7-chloro-2,3-dihydro-2-oxo-5-phenyl-1H-1,4-benzodiazepine-3-carboxylate | ChemIDplus |
| monopotassium clorazepate | ChemIDplus |