EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10ClN2O3 |
| Net Charge | -1 |
| Average Mass | 313.720 |
| Monoisotopic Mass | 313.03854 |
| SMILES | O=C([O-])C1N=C(c2ccccc2)c2cc(Cl)ccc2NC1=O |
| InChI | InChI=1S/C16H11ClN2O3/c17-10-6-7-12-11(8-10)13(9-4-2-1-3-5-9)19-14(16(21)22)15(20)18-12/h1-8,14H,(H,18,20)(H,21,22)/p-1 |
| InChIKey | XDDJGVMJFWAHJX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clorazepic acid anion (CHEBI:59590) is a monocarboxylic acid anion (CHEBI:35757) |
| clorazepic acid anion (CHEBI:59590) is conjugate base of clorazepic acid (CHEBI:3761) |
| Incoming Relation(s) |
| clorazepate monopotassium (CHEBI:59591) has part clorazepic acid anion (CHEBI:59590) |
| clorazepic acid (CHEBI:3761) is conjugate acid of clorazepic acid anion (CHEBI:59590) |
| IUPAC Name |
|---|
| 7-chloro-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepine-3-carboxylate |
| Synonyms | Source |
|---|---|
| 7-chloro-2,3-dihydro-2,2-dihydroxy-5-phenyl-1H-1,4-benzodiazepine-3-carboxylate | ChEBI |
| clorazepate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8125954 | Beilstein |