EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19BrN2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 435.318 |
| Monoisotopic Mass | 434.08412 |
| SMILES | CN(C)CC[C@@H](c1ccc(Br)cc1)c1ccccn1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H19BrN2.C4H4O4/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-9,11,15H,10,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t15-;/m0./s1 |
| InChIKey | SRGKFVAASLQVBO-DASCVMRKSA-N |
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexbrompheniramine maleate (CHEBI:59273) has part dexbrompheniramine (CHEBI:59269) |
| dexbrompheniramine maleate (CHEBI:59273) has role anti-allergic agent (CHEBI:50857) |
| dexbrompheniramine maleate (CHEBI:59273) has role H1-receptor antagonist (CHEBI:37955) |
| dexbrompheniramine maleate (CHEBI:59273) is a brompheniramine maleate (CHEBI:3184) |
| IUPAC Name |
|---|
| (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| (+)-2-(p-bromo-α-(2-dimethylaminoethyl)benzyl)pyridine maleate | ChEBI |
| (+)-3-(4-bromophenyl)-N,N-dimethyl-3-(2-pyridinyl)-1-propanamine maleate | ChEBI |
| (+)-3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine maleate | ChEBI |
| (+)-3-(p-bromophenyl)-3-(2-pyridyl)-N,N-dimethylpropylamine maleate | ChEBI |
| (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine maleate | ChEBI |
| Brompheniramine d-form maleate | ChEMBL |
| Brand Names | Source |
|---|---|
| Dexbrompheniramine maleate component of brompheril | ChEMBL |
| Dexbrompheniramine maleate component of disobrom | ChEMBL |
| Dexbrompheniramine maleate component of disophrol | ChEMBL |
| Dexbrompheniramine maleate component of drixoral | ChEMBL |
| Dexbrompheniramine maleate component of drixoral plus | ChEMBL |
| Dexbrompheniramine maleate component of resporal | ChEMBL |
| Citations |
|---|