EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19BrN2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 435.318 |
| Monoisotopic Mass | 434.08412 |
| SMILES | CN(C)CCC(c1ccc(Br)cc1)c1ccccn1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H19BrN2.C4H4O4/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-9,11,15H,10,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SRGKFVAASLQVBO-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. anti-allergic agent A drug used to treat allergic reactions. antitussive An agent that suppresses cough. Antitussives have a central or a peripheral action on the cough reflex, or a combination of both. Compare with expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing, and mucolytics, which decrease the viscosity of mucus, facilitating its removal by ciliary action and expectoration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brompheniramine maleate (CHEBI:3184) has part brompheniramine (CHEBI:3183) |
| brompheniramine maleate (CHEBI:3184) has role anti-allergic agent (CHEBI:50857) |
| brompheniramine maleate (CHEBI:3184) has role antitussive (CHEBI:51177) |
| brompheniramine maleate (CHEBI:3184) has role nasal decongestant (CHEBI:77715) |
| brompheniramine maleate (CHEBI:3184) is a maleate salt (CHEBI:50221) |
| Incoming Relation(s) |
| dexbrompheniramine maleate (CHEBI:59273) is a brompheniramine maleate (CHEBI:3184) |
| IUPAC Name |
|---|
| 3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 1-(p-bromophenyl)-1-(2-pyridyl)-3-dimethylaminopropane maleate | ChEBI |
| 2-(p-bromo-α-(2-dimethylaminoethyl)benzyl)pyridine maleate | ChEBI |
| 3-(4-bromophenyl)-N,N-dimethyl-3-(2-pyridinyl)-1-propanamine maleate | ChEBI |
| 3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine maleate | ChEBI |
| 3-(p-bromophenyl)-3-(2-pyridyl)-N,N-dimethylpropylamine maleate | ChEBI |
| brompheniramine maleate | KEGG DRUG |
| Brand Names | Source |
|---|---|
| Brompheniramine maleate component of biphetap | ChEMBL |
| Brompheniramine maleate component of bromanate | ChEMBL |
| Brompheniramine maleate component of bromanate dc | ChEMBL |
| Brompheniramine maleate component of bromanate dm | ChEMBL |
| Brompheniramine maleate component of bromatapp | ChEMBL |
| Brompheniramine maleate component of bromfed-dm | ChEMBL |
| Citations |
|---|