EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19BrN2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 435.318 |
| Monoisotopic Mass | 434.08412 |
| SMILES | CN(C)CCC(c1ccc(Br)cc1)c1ccccn1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H19BrN2.C4H4O4/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-9,11,15H,10,12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SRGKFVAASLQVBO-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Application: | anti-allergic agent A drug used to treat allergic reactions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brompheniramine maleate (CHEBI:3184) has part brompheniramine (CHEBI:3183) |
| brompheniramine maleate (CHEBI:3184) has role anti-allergic agent (CHEBI:50857) |
| brompheniramine maleate (CHEBI:3184) has role antitussive (CHEBI:51177) |
| brompheniramine maleate (CHEBI:3184) has role nasal decongestant (CHEBI:77715) |
| brompheniramine maleate (CHEBI:3184) is a maleate salt (CHEBI:50221) |
| brompheniramine maleate (CHEBI:3184) is a organic molecular entity (CHEBI:50860) |
| brompheniramine maleate (CHEBI:3184) is a racemate (CHEBI:60911) |
| Incoming Relation(s) |
| dexbrompheniramine maleate (CHEBI:59273) is a brompheniramine maleate (CHEBI:3184) |
| IUPAC Name |
|---|
| 3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine (2Z)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 1-(p-bromophenyl)-1-(2-pyridyl)-3-dimethylaminopropane maleate | ChEBI |
| 2-(p-bromo-α-(2-dimethylaminoethyl)benzyl)pyridine maleate | ChEBI |
| 3-(4-bromophenyl)-N,N-dimethyl-3-(2-pyridinyl)-1-propanamine maleate | ChEBI |
| 3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine maleate | ChEBI |
| 3-(p-bromophenyl)-3-(2-pyridyl)-N,N-dimethylpropylamine maleate | ChEBI |
| brompheniramine maleate | KEGG DRUG |
| Brand Names | Source |
|---|---|
| Brompheniramine maleate component of biphetap | ChEMBL |
| Brompheniramine maleate component of bromanate | ChEMBL |
| Brompheniramine maleate component of bromanate dc | ChEMBL |
| Brompheniramine maleate component of bromanate dm | ChEMBL |
| Brompheniramine maleate component of bromatapp | ChEMBL |
| Brompheniramine maleate component of bromfed-dm | ChEMBL |
| Citations |
|---|