EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19BrN2 |
| Net Charge | 0 |
| Average Mass | 319.246 |
| Monoisotopic Mass | 318.07316 |
| SMILES | CN(C)CC[C@@H](c1ccc(Br)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/t15-/m0/s1 |
| InChIKey | ZDIGNSYAACHWNL-HNNXBMFYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexbrompheniramine (CHEBI:59269) has role anti-allergic agent (CHEBI:50857) |
| dexbrompheniramine (CHEBI:59269) has role H1-receptor antagonist (CHEBI:37955) |
| dexbrompheniramine (CHEBI:59269) is a brompheniramine (CHEBI:3183) |
| Incoming Relation(s) |
| dexbrompheniramine maleate (CHEBI:59273) has part dexbrompheniramine (CHEBI:59269) |
| IUPAC Name |
|---|
| (3S)-3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine |
| INNs | Source |
|---|---|
| dexbrompheniramine | ChemIDplus |
| dexbromfeniramina | ChemIDplus |
| dexbrompheniraminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| d-brompheniramine | ChemIDplus |
| (+)-brompheniraminum | ChEBI |
| (S)-brompheniramine | ChEBI |
| (S)-(+)-brompheniramine | ChEBI |