EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19BrN2 |
| Net Charge | 0 |
| Average Mass | 319.246 |
| Monoisotopic Mass | 318.07316 |
| SMILES | CN(C)CCC(c1ccc(Br)cc1)c1ccccn1 |
| InChI | InChI=1S/C16H19BrN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3 |
| InChIKey | ZDIGNSYAACHWNL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brompheniramine (CHEBI:3183) has role anti-allergic agent (CHEBI:50857) |
| brompheniramine (CHEBI:3183) has role H1-receptor antagonist (CHEBI:37955) |
| brompheniramine (CHEBI:3183) is a organobromine compound (CHEBI:37141) |
| brompheniramine (CHEBI:3183) is a pyridines (CHEBI:26421) |
| Incoming Relation(s) |
| brompheniramine maleate (CHEBI:3184) has part brompheniramine (CHEBI:3183) |
| dexbrompheniramine (CHEBI:59269) is a brompheniramine (CHEBI:3183) |
| IUPAC Name |
|---|
| 3-(4-bromophenyl)-N,N-dimethyl-3-(pyridin-2-yl)propan-1-amine |
| INNs | Source |
|---|---|
| bromfeniramina | ChemIDplus |
| brompheniramine | ChemIDplus |
| brompheniraminum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(p-bromophenyl)-1-(2-pyridyl)-3-dimethylaminopropane | ChemIDplus |
| 2-(p-bromo-α-(2-dimethylaminoethyl)benzyl)pyridine | ChemIDplus |
| [3-(4-Bromo-phenyl)-3-pyridin-2-yl-propyl]-dimethyl-amine | ChEMBL |
| 3-(4-bromophenyl)-N,N-dimethyl-3-(2-pyridinyl)-1-propanamine | NIST Chemistry WebBook |
| 3-(p-bromophenyl)-3-(2-pyridyl)-N,N-dimethylpropylamine | ChemIDplus |
| Brompheniramine | KEGG COMPOUND |
| Citations |
|---|