EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H11Cl4N2O5S |
| Net Charge | -1 |
| Average Mass | 521.185 |
| Monoisotopic Mass | 518.91483 |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1cc(Cl)ccc1Oc1ccc(Cl)cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C19H12Cl4N2O5S/c20-10-1-5-16(30-17-6-2-11(21)8-18(17)31(27,28)29)15(7-10)25-19(26)24-12-3-4-13(22)14(23)9-12/h1-9H,(H2,24,25,26)(H,27,28,29)/p-1 |
| InChIKey | MKUMTCOTMQPYTQ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulcofuronate (CHEBI:59248) is a organosulfonate oxoanion (CHEBI:33554) |
| sulcofuronate (CHEBI:59248) is conjugate base of sulcofuron (CHEBI:59246) |
| Incoming Relation(s) |
| sulcofuron-sodium (CHEBI:59247) has part sulcofuronate (CHEBI:59248) |
| sulcofuron (CHEBI:59246) is conjugate acid of sulcofuronate (CHEBI:59248) |
| IUPAC Name |
|---|
| 5-chloro-2-(4-chloro-2-{[(3,4-dichlorophenyl)carbamoyl]amino}phenoxy)benzene-1-sulfonate |
| Synonym | Source |
|---|---|
| sulcofuron anion | ChEBI |