EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H11Cl4N2O5S.Na |
| Net Charge | 0 |
| Average Mass | 544.175 |
| Monoisotopic Mass | 541.90405 |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Nc1cc(Cl)ccc1Oc1ccc(Cl)cc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C19H12Cl4N2O5S.Na/c20-10-1-5-16(30-17-6-2-11(21)8-18(17)31(27,28)29)15(7-10)25-19(26)24-12-3-4-13(22)14(23)9-12;/h1-9H,(H2,24,25,26)(H,27,28,29);/q;+1/p-1 |
| InChIKey | NMGNJWORLGLLHQ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulcofuron-sodium (CHEBI:59247) has part sulcofuronate (CHEBI:59248) |
| sulcofuron-sodium (CHEBI:59247) has role epitope (CHEBI:53000) |
| sulcofuron-sodium (CHEBI:59247) is a organic sodium salt (CHEBI:38700) |
| sulcofuron-sodium (CHEBI:59247) is a organochlorine insecticide (CHEBI:25705) |
| sulcofuron-sodium (CHEBI:59247) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| sodium 5-chloro-2-(4-chloro-2-{[(3,4-dichlorophenyl)carbamoyl]amino}phenoxy)benzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| Sulcofuron | ChemIDplus |
| N-(3,4-Dichlorophenyl)-N'-2-(2-sulfo-4-chlorophenoxy)-5-chlorophenyl urea sodium salt | ChemIDplus |
| N-3,4-Dichlorophenyl N-5-chloro-2-(2-sodium sulfonyl-4-chlorophenoxy)phenyl urea | ChemIDplus |
| Sodium 5-chloro-2-(4-chloro-2-(3-(3,4-dichlorophenyl)-ureido)phenoxy)benzenesulfonate | ChemIDplus |
| Sodium 5-chloro-2-(4-chloro-2-((((3,4-dichlorophenyl)amino)carbonyl)amino)phenoxy)benzenesulphonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14188156 | Reaxys |
| CAS:3567-25-7 | ChemIDplus |
| Citations |
|---|