EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16N3O6S2 |
| Net Charge | -1 |
| Average Mass | 422.464 |
| Monoisotopic Mass | 422.04860 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)CSc1ccncc1 |
| InChI | InChI=1S/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/p-1/t13-,16-/m1/s1 |
| InChIKey | UQLLWWBDSUHNEB-CZUORRHYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephapirin(1−) (CHEBI:59217) is a cephalosporin carboxylic acid anion (CHEBI:52440) |
| cephapirin(1−) (CHEBI:59217) is conjugate base of cephapirin (CHEBI:554446) |
| Incoming Relation(s) |
| cephapirin sodium (CHEBI:3545) has part cephapirin(1−) (CHEBI:59217) |
| cephapirin (CHEBI:554446) is conjugate acid of cephapirin(1−) (CHEBI:59217) |
| IUPAC Name |
|---|
| (6R,7R)-3-[(acetyloxy)methyl]-8-oxo-7-{[(pyridin-4-ylsulfanyl)acetyl]amino}-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| Synonyms | Source |
|---|---|
| (6R,7R)-3-(hydroxymethyl)-8-oxo-7-(2-(4-pyridylthio)acetamido)-5-thia-1-azabicyclo(4.2.0)oct-2-ene-2-carboxylate acetate | ChEBI |
| 7-(pyrid-4-ylthioacetamido)cephalosporanate | ChEBI |
| cephapirin anion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4894074 | Beilstein |