EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N3O6S2 |
| Net Charge | 0 |
| Average Mass | 423.472 |
| Monoisotopic Mass | 423.05588 |
| SMILES | [H][C@]12SCC(COC(C)=O)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)CSc1ccncc1 |
| InChI | InChI=1S/C17H17N3O6S2/c1-9(21)26-6-10-7-28-16-13(15(23)20(16)14(10)17(24)25)19-12(22)8-27-11-2-4-18-5-3-11/h2-5,13,16H,6-8H2,1H3,(H,19,22)(H,24,25)/t13-,16-/m1/s1 |
| InChIKey | UQLLWWBDSUHNEB-CZUORRHYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cephapirin (CHEBI:554446) has role antibacterial drug (CHEBI:36047) |
| cephapirin (CHEBI:554446) is a cephalosporin (CHEBI:23066) |
| cephapirin (CHEBI:554446) is conjugate acid of cephapirin(1−) (CHEBI:59217) |
| Incoming Relation(s) |
| cephapirin(1−) (CHEBI:59217) is conjugate base of cephapirin (CHEBI:554446) |
| IUPAC Name |
|---|
| (6R,7R)-3-acetoxymethyl-7-[(pyridin-4-ylsulfanyl)acetamido]-3,4-didehydrocepham-4-carboxylic acid |
| INNs | Source |
|---|---|
| cefapirin | ChemIDplus |
| cefapirina | DrugBank |
| cefapirine | DrugBank |
| cefapirinum | DrugBank |
| Synonyms | Source |
|---|---|
| (6R,7R)-3-(acetoxymethyl)-8-oxo-7-{[(pyridin-4-ylsulfanyl)acetyl]amino}-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid | ChEBI |
| Cefaprin | DrugBank |
| Cephapirine | DrugBank |
| CEPR | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1845 | VSDB |
| 575 | DrugCentral |
| C06896 | KEGG COMPOUND |
| Cephapirin | Wikipedia |
| D07636 | KEGG DRUG |
| DB01139 | DrugBank |
| HMDB0015270 | HMDB |
| HMDB0030451 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4031966 | Reaxys |
| Beilstein:4031996 | Beilstein |
| CAS:21593-23-7 | KEGG COMPOUND |
| CAS:21593-23-7 | ChemIDplus |
| Citations |
|---|