EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35O5 |
| Net Charge | -1 |
| Average Mass | 367.506 |
| Monoisotopic Mass | 367.24900 |
| SMILES | CCCCC[C@](C)(O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)[O-])[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C21H36O5/c1-3-4-9-13-21(2,26)14-12-17-16(18(22)15-19(17)23)10-7-5-6-8-11-20(24)25/h5,7,12,14,16-19,22-23,26H,3-4,6,8-11,13,15H2,1-2H3,(H,24,25)/p-1/b7-5-,14-12+/t16-,17-,18+,19+,21+/m1/s1 |
| InChIKey | DLJKPYFALUEJCK-WJDSMEDOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboprost(1−) (CHEBI:59205) is a monocarboxylic acid anion (CHEBI:35757) |
| carboprost(1−) (CHEBI:59205) is conjugate base of carboprost (CHEBI:3403) |
| Incoming Relation(s) |
| carboprost tromethamine (CHEBI:3404) has part carboprost(1−) (CHEBI:59205) |
| carboprost (CHEBI:3403) is conjugate acid of carboprost(1−) (CHEBI:59205) |
| IUPAC Name |
|---|
| (5Z,9α,11β,13E,15S)-9,11,15-trihydroxy-15-methylprosta-5,13-dien-1-oate |
| Synonyms | Source |
|---|---|
| (15S)-15-methyl-PGF2α(1−) | ChEBI |
| (15S)-15-methylprostaglandin F2α(1−) | ChEBI |
| 15(S)-15-methyl-PGF2α(1−) | ChEBI |
| 15(S)-15-methylprostaglandin F2α(1−) | ChEBI |
| (15S)-15-methyl-PGF2α anion | ChEBI |
| (15S)-15-methylprostaglandin F2α anion | ChEBI |