EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35O5.C4H12NO3 |
| Net Charge | 0 |
| Average Mass | 489.650 |
| Monoisotopic Mass | 489.33017 |
| SMILES | CCCCC[C@](C)(O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)[O-])[C@@H](O)C[C@@H]1O.[NH3+]C(CO)(CO)CO |
| InChI | InChI=1S/C21H36O5.C4H11NO3/c1-3-4-9-13-21(2,26)14-12-17-16(18(22)15-19(17)23)10-7-5-6-8-11-20(24)25;5-4(1-6,2-7)3-8/h5,7,12,14,16-19,22-23,26H,3-4,6,8-11,13,15H2,1-2H3,(H,24,25);6-8H,1-3,5H2/b7-5-,14-12+;/t16-,17-,18+,19+,21+;/m1./s1 |
| InChIKey | UMMADZJLZAPZAW-OVXHCKHTSA-N |
| Roles Classification |
|---|
| Applications: | oxytocic A drug that stimulates contraction of the myometrium. Oxytocics are used to induce labour, obstetric at term, to prevent or control postpartum or postabortion haemorrhage, and to assess foetal status in high risk pregnancies. They may also be used alone or with other drugs to induce abortions (abortifacients). abortifacient A chemical substance that interrupts pregnancy after implantation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carboprost tromethamine (CHEBI:3404) has part carboprost(1−) (CHEBI:59205) |
| carboprost tromethamine (CHEBI:3404) has part Htris (CHEBI:46097) |
| carboprost tromethamine (CHEBI:3404) has role abortifacient (CHEBI:50691) |
| carboprost tromethamine (CHEBI:3404) has role oxytocic (CHEBI:36063) |
| carboprost tromethamine (CHEBI:3404) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| (5Z,9α,11β,13E,15S)-9,11,15-trihydroxy-15-methylprosta-5,13-dien-1-oic acid - 2-amino-2-(hydroxymethyl)propane-1,3-diol (1:1) |
| Synonyms | Source |
|---|---|
| 1,3-dihydroxy-2-(hydroxymethyl)propan-2-aminium (5Z,9α,11β,13E,15S)-9,11,15-trihydroxy-15-methylprosta-5,13-dien-1-oate | IUPAC |
| (15S)-15-methyl-PGF2α tromethamine salt | ChemIDplus |
| 15(S)-15-methyl-PGF2α tromethamine salt | ChemIDplus |
| (15S)-15-methylprostaglandin F2α tromethamine | ChemIDplus |
| 15(S)-15-methylprostaglandin F2α tromethamine | ChemIDplus |
| carboprost trometamol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:58551-69-2 | ChemIDplus |