EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N2 |
| Net Charge | 0 |
| Average Mass | 260.340 |
| Monoisotopic Mass | 260.13135 |
| SMILES | c1ccc(Nc2ccc(Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H16N2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14,19-20H |
| InChIKey | UTGQNNCQYDRXCH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-diphenyl-1,4-phenylenediamine (CHEBI:34860) has functional parent p-aminodiphenylamine (CHEBI:59038) |
| N,N'-diphenyl-1,4-phenylenediamine (CHEBI:34860) has role antioxidant (CHEBI:22586) |
| N,N'-diphenyl-1,4-phenylenediamine (CHEBI:34860) is a N-substituted diamine (CHEBI:50441) |
| N,N'-diphenyl-1,4-phenylenediamine (CHEBI:34860) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N,N'-diphenylbenzene-1,4-diamine |
| Synonyms | Source |
|---|---|
| 1,4-bis(phenylamino)benzene | NIST Chemistry WebBook |
| 1,4-dianilinobenzene | NIST Chemistry WebBook |
| 4,4'-diphenyl-p-phenylenediamine | NIST Chemistry WebBook |
| 4-phenylaminodiphenylamine | NIST Chemistry WebBook |
| diphenyl-p-phenylenediamine | NIST Chemistry WebBook |
| DPPD | KEGG COMPOUND |
| Citations |
|---|