EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11I4NO7S |
| Net Charge | 0 |
| Average Mass | 856.936 |
| Monoisotopic Mass | 856.64351 |
| SMILES | NC(Cc1cc(I)c(Oc2cc(I)c(OS(=O)(=O)O)c(I)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C15H11I4NO7S/c16-8-1-6(3-12(20)15(21)22)2-9(17)13(8)26-7-4-10(18)14(11(19)5-7)27-28(23,24)25/h1-2,4-5,12H,3,20H2,(H,21,22)(H,23,24,25) |
| InChIKey | QYXIJUZWSSQICT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thyroxine sulfate (CHEBI:53508) has functional parent thyroxine (CHEBI:30660) |
| thyroxine sulfate (CHEBI:53508) is a iodothyronine (CHEBI:24864) |
| thyroxine sulfate (CHEBI:53508) is conjugate acid of thyroxine sulfate(1−) (CHEBI:58910) |
| Incoming Relation(s) |
| thyroxine sulfate(1−) (CHEBI:58910) is conjugate base of thyroxine sulfate (CHEBI:53508) |
| IUPAC Name |
|---|
| thyroxine 4-sulfate |
| Synonyms | Source |
|---|---|
| T4S | SUBMITTER |
| Thyroxine-4-sulfate | ChemIDplus |
| T4 Sulfate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:77074-49-8 | ChemIDplus |