EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14NO4 |
| Net Charge | -1 |
| Average Mass | 188.203 |
| Monoisotopic Mass | 188.09283 |
| SMILES | CCC[C@H]([NH2+][C@H](C)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H15NO4/c1-3-4-6(8(12)13)9-5(2)7(10)11/h5-6,9H,3-4H2,1-2H3,(H,10,11)(H,12,13)/p-1/t5-,6+/m1/s1 |
| InChIKey | AMDDRMIFTJHJGD-RITPCOANSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate (CHEBI:58799) is a α-amino-acid anion (CHEBI:33558) |
| (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate (CHEBI:58799) is conjugate base of (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) |
| (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate (CHEBI:58799) is tautomer of (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) |
| Incoming Relation(s) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) is conjugate acid of (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate (CHEBI:58799) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) is tautomer of (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate (CHEBI:58799) |
| IUPAC Name |
|---|
| (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate |
| Synonym | Source |
|---|---|
| (2S)-2-{[(1R)-1-carboxylatoethyl]ammonio}pentanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2S)-2-[(R)-1-carboxyethylamino]pentanoate | UniProt |