EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14NO4 |
| Net Charge | -1 |
| Average Mass | 188.203 |
| Monoisotopic Mass | 188.09283 |
| SMILES | CCC[C@H](N[C@H](C)C(=O)O)C(=O)[O-] |
| InChI | InChI=1S/C8H15NO4/c1-3-4-6(8(12)13)9-5(2)7(10)11/h5-6,9H,3-4H2,1-2H3,(H,10,11)(H,12,13)/p-1/t5-,6+/m1/s1 |
| InChIKey | AMDDRMIFTJHJGD-RITPCOANSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) has functional parent valerate (CHEBI:31011) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) is a dicarboxylic acid monoanion (CHEBI:35695) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) is conjugate base of (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) is tautomer of (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate (CHEBI:58799) |
| Incoming Relation(s) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) is conjugate acid of (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) |
| (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate (CHEBI:58799) is tautomer of (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) |
| IUPAC Names |
|---|
| (2S)-2-{[(1R)-1-carboxyethyl]amino}pentanoate |
| N-[(1R)-1-carboxyethyl]-L-norvalinate |
| Synonyms | Source |
|---|---|
| (2S)-2-{[1-(R)-Carboxyethyl]amino}pentanoate | KEGG COMPOUND |
| (2S)-2-{[(1R)-1-carboxyethyl]amino}valerate | ChEBI |
| (2S)-2-{[1-(R)-carboxyethyl]amino}pentanoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C06326 | KEGG COMPOUND |