EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO4 |
| Net Charge | 0 |
| Average Mass | 189.211 |
| Monoisotopic Mass | 189.10011 |
| SMILES | CCC[C@H](N[C@H](C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H15NO4/c1-3-4-6(8(12)13)9-5(2)7(10)11/h5-6,9H,3-4H2,1-2H3,(H,10,11)(H,12,13)/t5-,6+/m1/s1 |
| InChIKey | AMDDRMIFTJHJGD-RITPCOANSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) has functional parent valeric acid (CHEBI:17418) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) is a amino dicarboxylic acid (CHEBI:36164) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) is conjugate acid of (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) is conjugate acid of (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate (CHEBI:58799) |
| Incoming Relation(s) |
| (2S)-2-[(R)-1-carboxyethylamino]pentanoate (CHEBI:15602) is conjugate base of (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) |
| (2S)-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate (CHEBI:58799) is conjugate base of (2S)-2-[(R)-1-carboxyethylamino]pentanoic acid (CHEBI:49259) |
| IUPAC Names |
|---|
| N-[(1R)-1-carboxyethyl]-L-norvaline |
| (2S)-2-{[(1R)-1-carboxyethyl]amino}pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| C06326 | KEGG COMPOUND |