EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8NO4 |
| Net Charge | -1 |
| Average Mass | 158.133 |
| Monoisotopic Mass | 158.04588 |
| SMILES | C=C(C[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H9NO4/c1-3(5(8)9)2-4(7)6(10)11/h4H,1-2,7H2,(H,8,9)(H,10,11)/p-1/t4-/m0/s1 |
| InChIKey | RCCMXKJGURLWPB-BYPYZUCNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylene-L-glutamate(1−) (CHEBI:58733) is a α-amino-acid anion (CHEBI:33558) |
| 4-methylene-L-glutamate(1−) (CHEBI:58733) is conjugate acid of 4-methylene-L-glutamate(2−) (CHEBI:17299) |
| 4-methylene-L-glutamate(1−) (CHEBI:58733) is conjugate base of 4-methylene-L-glutamic acid (CHEBI:48031) |
| Incoming Relation(s) |
| 4-methylene-L-glutamic acid (CHEBI:48031) is conjugate acid of 4-methylene-L-glutamate(1−) (CHEBI:58733) |
| 4-methylene-L-glutamate(2−) (CHEBI:17299) is conjugate base of 4-methylene-L-glutamate(1−) (CHEBI:58733) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-methylenepentanedioate |
| UniProt Name | Source |
|---|---|
| 4-methylene-L-glutamate | UniProt |